C20H19N3O2S — CID 6997960
(5R)-5-(benzyliminomethyl)-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 6997960) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is (5R)-5-(benzyliminomethyl)-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5R)-5-(benzyliminomethyl)-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 6997960 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (5R)-5-(benzyliminomethyl)-1-(2,5-dimethylphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)[C@H](/C=N/Cc3ccccc3)C(=O)NC2=S)c1 |
| InChI | InChI=1S/C20H19N3O2S/c1-13-8-9-14(2)17(10-13)23-19(25)16(18(24)22-20(23)26)12-21-11-15-6-4-3-5-7-15/h3-10,12,16H,11H2,1-2H3,(H,22,24,26)/b21-12+/t16-/m1/s1 |
| InChIKey | JYCQKNJNJKGAPY-SVZNOHIVSA-N |
| XLogP | 2.94 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|