About 7-hydroxyindol-2-one
7-hydroxyindol-2-one (PubChem CID 54408073) has the molecular formula C8H5NO2
and a molecular weight of 147.13 g/mol. Its IUPAC name is 7-hydroxyindol-2-one.
Molecular Properties
| Compound Name | 7-hydroxyindol-2-one |
| PubChem CID | 54408073 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 7-hydroxyindol-2-one |
| SMILES | O=C1C=c2cccc(O)c2=N1 |
| InChI | InChI=1S/C8H5NO2/c10-6-3-1-2-5-4-7(11)9-8(5)6/h1-4,10H |
| InChIKey | VSDZNKUXRNOJNL-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-hydroxyindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxyindol-2-one?
The IUPAC name of 7-hydroxyindol-2-one (CID 54408073) is 7-hydroxyindol-2-one.
What is the SMILES notation for 7-hydroxyindol-2-one?
The canonical SMILES for 7-hydroxyindol-2-one is O=C1C=c2cccc(O)c2=N1.
What is the InChIKey of 7-hydroxyindol-2-one?
The InChIKey is VSDZNKUXRNOJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2/c10-6-3-1-2-5-4-7(11)9-8(5)6/h1-4,10H.
What are the key properties of 7-hydroxyindol-2-one?
7-hydroxyindol-2-one has a molecular weight of 147.13 g/mol, XLogP of -0.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxyindol-2-one is sourced from PubChem (CID 54408073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).