C26H19NO4 — CID 70001257
methyl 6-hydroxy-7-(1H-phenalen-1-ylcarbamoyl)naphthalene-2-carboxylate (PubChem CID 70001257) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl 6-hydroxy-7-(1H-phenalen-1-ylcarbamoyl)naphthalene-2-carboxylate.
| Compound Name | methyl 6-hydroxy-7-(1H-phenalen-1-ylcarbamoyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 70001257 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | methyl 6-hydroxy-7-(1H-phenalen-1-ylcarbamoyl)naphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2cc(O)c(C(=O)NC3C=Cc4cccc5cccc3c45)cc2c1 |
| InChI | InChI=1S/C26H19NO4/c1-31-26(30)18-9-8-17-14-23(28)21(13-19(17)12-18)25(29)27-22-11-10-16-5-2-4-15-6-3-7-20(22)24(15)16/h2-14,22,28H,1H3,(H,27,29) |
| InChIKey | OUOQOVBUOHRDPX-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |