C19H26N2O2 — CID 70001332
cyclohept-2-en-1-yl 3-(piperazin-1-ylmethyl)benzoate (PubChem CID 70001332) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is cyclohept-2-en-1-yl 3-(piperazin-1-ylmethyl)benzoate.
| Compound Name | cyclohept-2-en-1-yl 3-(piperazin-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 70001332 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | cyclohept-2-en-1-yl 3-(piperazin-1-ylmethyl)benzoate |
| SMILES | O=C(OC1C=CCCCC1)c1cccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C19H26N2O2/c22-19(23-18-8-3-1-2-4-9-18)17-7-5-6-16(14-17)15-21-12-10-20-11-13-21/h3,5-8,14,18,20H,1-2,4,9-13,15H2 |
| InChIKey | FEZSXUJTZXRNNM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|