C21H28N2O3 — CID 139979639
cyclohept-2-en-1-yl 3-[(4-acetylpiperazin-1-yl)methyl]benzoate (PubChem CID 139979639) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is cyclohept-2-en-1-yl 3-[(4-acetylpiperazin-1-yl)methyl]benzoate.
| Compound Name | cyclohept-2-en-1-yl 3-[(4-acetylpiperazin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 139979639 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | cyclohept-2-en-1-yl 3-[(4-acetylpiperazin-1-yl)methyl]benzoate |
| SMILES | CC(=O)N1CCN(Cc2cccc(C(=O)OC3C=CCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H28N2O3/c1-17(24)23-13-11-22(12-14-23)16-18-7-6-8-19(15-18)21(25)26-20-9-4-2-3-5-10-20/h4,6-9,15,20H,2-3,5,10-14,16H2,1H3 |
| InChIKey | AZLGRBDZLNVXEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|