C17H16N4O3 — CID 70001760
3-[3-[(2-methoxyacetyl)amino]phenyl]indazole-1-carboxamide (PubChem CID 70001760) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 3-[3-[(2-methoxyacetyl)amino]phenyl]indazole-1-carboxamide.
| Compound Name | 3-[3-[(2-methoxyacetyl)amino]phenyl]indazole-1-carboxamide |
|---|---|
| PubChem CID | 70001760 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-[3-[(2-methoxyacetyl)amino]phenyl]indazole-1-carboxamide |
| SMILES | COCC(=O)Nc1cccc(-c2nn(C(N)=O)c3ccccc23)c1 |
| InChI | InChI=1S/C17H16N4O3/c1-24-10-15(22)19-12-6-4-5-11(9-12)16-13-7-2-3-8-14(13)21(20-16)17(18)23/h2-9H,10H2,1H3,(H2,18,23)(H,19,22) |
| InChIKey | FEMZBJUXXOOFFA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |