C21H24N2O2S — CID 70001902
(2R,4R)-N-benzyl-N-methyl-4-[2-(2-sulfanylphenyl)acetyl]pyrrolidine-2-carboxamide (PubChem CID 70001902) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is (2R,4R)-N-benzyl-N-methyl-4-[2-(2-sulfanylphenyl)acetyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-benzyl-N-methyl-4-[2-(2-sulfanylphenyl)acetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70001902 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (2R,4R)-N-benzyl-N-methyl-4-[2-(2-sulfanylphenyl)acetyl]pyrrolidine-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@H]1C[C@@H](C(=O)Cc2ccccc2S)CN1 |
| InChI | InChI=1S/C21H24N2O2S/c1-23(14-15-7-3-2-4-8-15)21(25)18-11-17(13-22-18)19(24)12-16-9-5-6-10-20(16)26/h2-10,17-18,22,26H,11-14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | PYQNVIGRGIUMAO-QZTJIDSGSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|