C12H13NO3 — CID 7000193
(3S)-N-prop-2-enyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 7000193) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is (3S)-N-prop-2-enyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-prop-2-enyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 7000193 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3S)-N-prop-2-enyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | C=CCNC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C12H13NO3/c1-2-7-13-12(14)11-8-15-9-5-3-4-6-10(9)16-11/h2-6,11H,1,7-8H2,(H,13,14)/t11-/m0/s1 |
| InChIKey | PNMWAHCSBXANLU-NSHDSACASA-N |
| XLogP | 1.13 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|