C9H13NO4 — CID 70003963
(1S,2S,3S)-2-[(S)-amino(carboxy)methyl]-3-prop-2-enylcyclopropane-1-carboxylic acid (PubChem CID 70003963) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (1S,2S,3S)-2-[(S)-amino(carboxy)methyl]-3-prop-2-enylcyclopropane-1-carboxylic acid.
| Compound Name | (1S,2S,3S)-2-[(S)-amino(carboxy)methyl]-3-prop-2-enylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70003963 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1S,2S,3S)-2-[(S)-amino(carboxy)methyl]-3-prop-2-enylcyclopropane-1-carboxylic acid |
| SMILES | C=CC[C@@H]1[C@H](C(=O)O)[C@H]1[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H13NO4/c1-2-3-4-5(6(4)8(11)12)7(10)9(13)14/h2,4-7H,1,3,10H2,(H,11,12)(H,13,14)/t4-,5-,6-,7-/m0/s1 |
| InChIKey | SDJNFQDFKHLFTH-AXMZGBSTSA-N |
| XLogP | -0.08 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|