C7H10O3 — CID 70003005
(1S,2S,3S)-2-ethenyl-3-(hydroxymethyl)cyclopropane-1-carboxylic acid (PubChem CID 70003005) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (1S,2S,3S)-2-ethenyl-3-(hydroxymethyl)cyclopropane-1-carboxylic acid.
| Compound Name | (1S,2S,3S)-2-ethenyl-3-(hydroxymethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70003005 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (1S,2S,3S)-2-ethenyl-3-(hydroxymethyl)cyclopropane-1-carboxylic acid |
| SMILES | C=C[C@H]1[C@H](CO)[C@H]1C(=O)O |
| InChI | InChI=1S/C7H10O3/c1-2-4-5(3-8)6(4)7(9)10/h2,4-6,8H,1,3H2,(H,9,10)/t4-,5-,6-/m0/s1 |
| InChIKey | MFPHSAAVBHOVEB-ZLUOBGJFSA-N |
| XLogP | 0.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|