C22H36N2O3 — CID 70004571
tert-butyl (3S)-3-(methylamino)-4-[(2-methylpropan-2-yl)oxy]-4-(4-propan-2-ylphenyl)iminobutanoate (PubChem CID 70004571) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is tert-butyl (3S)-3-(methylamino)-4-[(2-methylpropan-2-yl)oxy]-4-(4-propan-2-ylphenyl)iminobutanoate.
| Compound Name | tert-butyl (3S)-3-(methylamino)-4-[(2-methylpropan-2-yl)oxy]-4-(4-propan-2-ylphenyl)iminobutanoate |
|---|---|
| PubChem CID | 70004571 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | tert-butyl (3S)-3-(methylamino)-4-[(2-methylpropan-2-yl)oxy]-4-(4-propan-2-ylphenyl)iminobutanoate |
| SMILES | CN[C@@H](CC(=O)OC(C)(C)C)/C(=N/c1ccc(C(C)C)cc1)OC(C)(C)C |
| InChI | InChI=1S/C22H36N2O3/c1-15(2)16-10-12-17(13-11-16)24-20(27-22(6,7)8)18(23-9)14-19(25)26-21(3,4)5/h10-13,15,18,23H,14H2,1-9H3/b24-20-/t18-/m0/s1 |
| InChIKey | IVWMDOBUHMTJCX-FCFMXISVSA-N |
| XLogP | 4.97 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|