C23H26N2O5 — CID 70005902
ethyl 2-[2-(2-oxopiperidin-1-yl)-5-[(2-phenylacetyl)amino]phenoxy]acetate (PubChem CID 70005902) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl 2-[2-(2-oxopiperidin-1-yl)-5-[(2-phenylacetyl)amino]phenoxy]acetate.
| Compound Name | ethyl 2-[2-(2-oxopiperidin-1-yl)-5-[(2-phenylacetyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 70005902 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | ethyl 2-[2-(2-oxopiperidin-1-yl)-5-[(2-phenylacetyl)amino]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(NC(=O)Cc2ccccc2)ccc1N1CCCCC1=O |
| InChI | InChI=1S/C23H26N2O5/c1-2-29-23(28)16-30-20-15-18(24-21(26)14-17-8-4-3-5-9-17)11-12-19(20)25-13-7-6-10-22(25)27/h3-5,8-9,11-12,15H,2,6-7,10,13-14,16H2,1H3,(H,24,26) |
| InChIKey | HRVAZODCKMRHHZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |