About 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole
3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole (PubChem CID 70005985) has the molecular formula C11H10N2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole |
| PubChem CID | 70005985 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole |
| SMILES | Cc1cccc2c1sc1c(C)[nH]nc12 |
| InChI | InChI=1S/C11H10N2S/c1-6-4-3-5-8-9-11(14-10(6)8)7(2)12-13-9/h3-5H,1-2H3,(H,12,13) |
| InChIKey | ZQWZPHOYXUBDGE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole?
The IUPAC name of 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole (CID 70005985) is 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole.
What is the SMILES notation for 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole?
The canonical SMILES for 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole is Cc1cccc2c1sc1c(C)[nH]nc12.
What is the InChIKey of 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole?
The InChIKey is ZQWZPHOYXUBDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2S/c1-6-4-3-5-8-9-11(14-10(6)8)7(2)12-13-9/h3-5H,1-2H3,(H,12,13).
What are the key properties of 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole?
3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole has a molecular weight of 202.28 g/mol, XLogP of 3.39, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole is sourced from PubChem (CID 70005985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).