C11H10N2S — CID 70005985
3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole (PubChem CID 70005985) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole.
| Compound Name | 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole |
|---|---|
| PubChem CID | 70005985 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 3,5-dimethyl-2H-[1]benzothiolo[3,2-c]pyrazole |
| SMILES | Cc1cccc2c1sc1c(C)[nH]nc12 |
| InChI | InChI=1S/C11H10N2S/c1-6-4-3-5-8-9-11(14-10(6)8)7(2)12-13-9/h3-5H,1-2H3,(H,12,13) |
| InChIKey | ZQWZPHOYXUBDGE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |