C29H30N2O3 — CID 70008160
(4-benzylpiperidin-1-yl)-(6-methoxy-7-phenylmethoxy-1H-indol-2-yl)methanone (PubChem CID 70008160) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-(6-methoxy-7-phenylmethoxy-1H-indol-2-yl)methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-(6-methoxy-7-phenylmethoxy-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 70008160 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-(6-methoxy-7-phenylmethoxy-1H-indol-2-yl)methanone |
| SMILES | COc1ccc2cc(C(=O)N3CCC(Cc4ccccc4)CC3)[nH]c2c1OCc1ccccc1 |
| InChI | InChI=1S/C29H30N2O3/c1-33-26-13-12-24-19-25(30-27(24)28(26)34-20-23-10-6-3-7-11-23)29(32)31-16-14-22(15-17-31)18-21-8-4-2-5-9-21/h2-13,19,22,30H,14-18,20H2,1H3 |
| InChIKey | YYFCIIVHGGAIBO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |