C10H10N4O — CID 70009267
5-amino-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one (PubChem CID 70009267) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 5-amino-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one.
| Compound Name | 5-amino-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 70009267 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 5-amino-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
| SMILES | NC1=NC=C2C=CC(=O)NC3=C2N1CC3 |
| InChI | InChI=1S/C10H10N4O/c11-10-12-5-6-1-2-8(15)13-7-3-4-14(10)9(6)7/h1-2,5H,3-4H2,(H2,11,12)(H,13,15) |
| InChIKey | XUXDVFHPDYYYME-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |