C14H17N3O — CID 70008594
5-(2-methylpropyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one (PubChem CID 70008594) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is 5-(2-methylpropyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one.
| Compound Name | 5-(2-methylpropyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
|---|---|
| PubChem CID | 70008594 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 5-(2-methylpropyl)-4,6,12-triazatricyclo[6.4.1.04,13]trideca-1(13),5,7,9-tetraen-11-one |
| SMILES | CC(C)CC1=NC=C2C=CC(=O)NC3=C2N1CC3 |
| InChI | InChI=1S/C14H17N3O/c1-9(2)7-12-15-8-10-3-4-13(18)16-11-5-6-17(12)14(10)11/h3-4,8-9H,5-7H2,1-2H3,(H,16,18) |
| InChIKey | VEGGMEDUACDQGJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |