C47H61N2O11P — CID 70011212
1-O-[[[di(propan-2-yl)amino]-[2-[(4-methoxybenzoyl)amino]ethoxy]phosphanyl]methyl] 3-O-ethyl 2-ethyl-2-[tris(4-methoxyphenyl)methoxymethyl]propanedioate (PubChem CID 70011212) has the molecular formula C47H61N2O11P and a molecular weight of 860.98 g/mol. Its IUPAC name is 1-O-[[[di(propan-2-yl)amino]-[2-[(4-methoxybenzoyl)amino]ethoxy]phosphanyl]methyl] 3-O-ethyl 2-ethyl-2-[tris(4-methoxyphenyl)methoxymethyl]propanedioate.
| Compound Name | 1-O-[[[di(propan-2-yl)amino]-[2-[(4-methoxybenzoyl)amino]ethoxy]phosphanyl]methyl] 3-O-ethyl 2-ethyl-2-[tris(4-methoxyphenyl)methoxymethyl]propanedioate |
|---|---|
| PubChem CID | 70011212 |
| Molecular Formula | C47H61N2O11P |
| Molecular Weight | 860.98 g/mol |
| Exact Mass | 860.40 |
| IUPAC Name | 1-O-[[[di(propan-2-yl)amino]-[2-[(4-methoxybenzoyl)amino]ethoxy]phosphanyl]methyl] 3-O-ethyl 2-ethyl-2-[tris(4-methoxyphenyl)methoxymethyl]propanedioate |
| SMILES | CCOC(=O)C(CC)(COC(c1ccc(OC)cc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)C(=O)OCP(OCCNC(=O)c1ccc(OC)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C47H61N2O11P/c1-11-46(44(51)57-12-2,45(52)58-32-61(49(33(3)4)34(5)6)60-30-29-48-43(50)35-13-21-39(53-7)22-14-35)31-59-47(36-15-23-40(54-8)24-16-36,37-17-25-41(55-9)26-18-37)38-19-27-42(56-10)28-20-38/h13-28,33-34H,11-12,29-32H2,1-10H3,(H,48,50) |
| InChIKey | HOOMLNQAODTXHP-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 140.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.98 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|