C35H43F2N3O3 — CID 70011418
3-N-cyclohexyl-3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,5-dimethylbenzene-1,3-dicarboxamide (PubChem CID 70011418) has the molecular formula C35H43F2N3O3 and a molecular weight of 591.74 g/mol. Its IUPAC name is 3-N-cyclohexyl-3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,5-dimethylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-cyclohexyl-3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,5-dimethylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 70011418 |
| Molecular Formula | C35H43F2N3O3 |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | 3-N-cyclohexyl-3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,5-dimethylbenzene-1,3-dicarboxamide |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)N(C(=O)c2cc(C)cc(C(=O)NC)c2)C2CCCCC2)c1 |
| InChI | InChI=1S/C35H43F2N3O3/c1-4-24-9-8-10-25(15-24)21-39-22-33(41)32(18-26-16-29(36)20-30(37)17-26)40(31-11-6-5-7-12-31)35(43)28-14-23(2)13-27(19-28)34(42)38-3/h8-10,13-17,19-20,31-33,39,41H,4-7,11-12,18,21-22H2,1-3H3,(H,38,42)/t32-,33+/m0/s1 |
| InChIKey | UZPDVBVCDVKPSF-JHOUSYSJSA-N |
| XLogP | 5.73 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |