C36H43F2N3O3 — CID 154452515
3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide (PubChem CID 154452515) has the molecular formula C36H43F2N3O3 and a molecular weight of 603.75 g/mol. Its IUPAC name is 3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 154452515 |
| Molecular Formula | C36H43F2N3O3 |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 603.33 |
| IUPAC Name | 3-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-1-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
| SMILES | CC#Cc1cc(C(=O)NCCC)cc(C(=O)N(CCC)[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(CC)c2)c1 |
| InChI | InChI=1S/C36H43F2N3O3/c1-5-10-26-16-29(35(43)40-13-6-2)21-30(17-26)36(44)41(14-7-3)33(20-28-18-31(37)22-32(38)19-28)34(42)24-39-23-27-12-9-11-25(8-4)15-27/h9,11-12,15-19,21-22,33-34,39,42H,6-8,13-14,20,23-24H2,1-4H3,(H,40,43)/t33-,34+/m0/s1 |
| InChIKey | WLIZZEACKBKBCJ-SZAHLOSFSA-N |
| XLogP | 5.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|