C24H15FN4O2 — CID 70012237
1-(4-fluorophenyl)-4-oxo-N-quinolin-2-yl-1,8-naphthyridine-3-carboxamide (PubChem CID 70012237) has the molecular formula C24H15FN4O2 and a molecular weight of 410.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-oxo-N-quinolin-2-yl-1,8-naphthyridine-3-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-4-oxo-N-quinolin-2-yl-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 70012237 |
| Molecular Formula | C24H15FN4O2 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-(4-fluorophenyl)-4-oxo-N-quinolin-2-yl-1,8-naphthyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2n1)c1cn(-c2ccc(F)cc2)c2ncccc2c1=O |
| InChI | InChI=1S/C24H15FN4O2/c25-16-8-10-17(11-9-16)29-14-19(22(30)18-5-3-13-26-23(18)29)24(31)28-21-12-7-15-4-1-2-6-20(15)27-21/h1-14H,(H,27,28,31) |
| InChIKey | DKDCCGNAGBUSQD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |