C19H11F8N3O2 — CID 175802382
4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 175802382) has the molecular formula C19H11F8N3O2 and a molecular weight of 465.30 g/mol. Its IUPAC name is 4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 175802382 |
| Molecular Formula | C19H11F8N3O2 |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cn(-c2c(F)cc(F)cc2F)c2ncccc2c1=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H11F8N3O2/c1-8(18(23,24)19(25,26)27)29-17(32)11-7-30(14-12(21)5-9(20)6-13(14)22)16-10(15(11)31)3-2-4-28-16/h2-8H,1H3,(H,29,32) |
| InChIKey | DGGIPVKIMBXOIA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|