C23H17BrF8N4O3 — CID 134360140
6-bromo-7-(3-hydroxypyrrolidin-1-yl)-4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide (PubChem CID 134360140) has the molecular formula C23H17BrF8N4O3 and a molecular weight of 629.30 g/mol. Its IUPAC name is 6-bromo-7-(3-hydroxypyrrolidin-1-yl)-4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide.
| Compound Name | 6-bromo-7-(3-hydroxypyrrolidin-1-yl)-4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 134360140 |
| Molecular Formula | C23H17BrF8N4O3 |
| Molecular Weight | 629.30 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | 6-bromo-7-(3-hydroxypyrrolidin-1-yl)-4-oxo-N-(3,3,4,4,4-pentafluorobutan-2-yl)-1-(2,4,6-trifluorophenyl)-1,8-naphthyridine-3-carboxamide |
| SMILES | CC(NC(=O)c1cn(-c2c(F)cc(F)cc2F)c2nc(N3CCC(O)C3)c(Br)cc2c1=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H17BrF8N4O3/c1-9(22(28,29)23(30,31)32)33-21(39)13-8-36(17-15(26)4-10(25)5-16(17)27)19-12(18(13)38)6-14(24)20(34-19)35-3-2-11(37)7-35/h4-6,8-9,11,37H,2-3,7H2,1H3,(H,33,39) |
| InChIKey | RXUCJILDYKAONE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|