C26H27BrN2O2 — CID 70016499
2-(2-aminophenyl)-8-[4-(4-bromophenyl)phenyl]-8-oxooctanamide (PubChem CID 70016499) has the molecular formula C26H27BrN2O2 and a molecular weight of 479.42 g/mol. Its IUPAC name is 2-(2-aminophenyl)-8-[4-(4-bromophenyl)phenyl]-8-oxooctanamide.
| Compound Name | 2-(2-aminophenyl)-8-[4-(4-bromophenyl)phenyl]-8-oxooctanamide |
|---|---|
| PubChem CID | 70016499 |
| Molecular Formula | C26H27BrN2O2 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 2-(2-aminophenyl)-8-[4-(4-bromophenyl)phenyl]-8-oxooctanamide |
| SMILES | NC(=O)C(CCCCCC(=O)c1ccc(-c2ccc(Br)cc2)cc1)c1ccccc1N |
| InChI | InChI=1S/C26H27BrN2O2/c27-21-16-14-19(15-17-21)18-10-12-20(13-11-18)25(30)9-3-1-2-7-23(26(29)31)22-6-4-5-8-24(22)28/h4-6,8,10-17,23H,1-3,7,9,28H2,(H2,29,31) |
| InChIKey | ZWXBXVUJBJAFHQ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|