C36H40F3N7O2 — CID 70019413
[(9aR)-4-benzhydryl-2-[[2-methoxy-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone (PubChem CID 70019413) has the molecular formula C36H40F3N7O2 and a molecular weight of 659.76 g/mol. Its IUPAC name is [(9aR)-4-benzhydryl-2-[[2-methoxy-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone.
| Compound Name | [(9aR)-4-benzhydryl-2-[[2-methoxy-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 70019413 |
| Molecular Formula | C36H40F3N7O2 |
| Molecular Weight | 659.76 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | [(9aR)-4-benzhydryl-2-[[2-methoxy-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-cyclopentylmethanone |
| SMILES | COc1ccc(-n2nnnc2C(F)(F)F)cc1CN1CC(C(c2ccccc2)c2ccccc2)N2CCN(C(=O)C3CCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C36H40F3N7O2/c1-48-32-17-16-29(46-35(36(37,38)39)40-41-42-46)20-28(32)21-43-22-30-23-44(34(47)27-14-8-9-15-27)18-19-45(30)31(24-43)33(25-10-4-2-5-11-25)26-12-6-3-7-13-26/h2-7,10-13,16-17,20,27,30-31,33H,8-9,14-15,18-19,21-24H2,1H3/t30-,31?/m1/s1 |
| InChIKey | FFRAQODJKZKMMY-PBBFAOSKSA-N |
| XLogP | 5.41 |
| TPSA | 79.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |