C32H35F3N6O2 — CID 22674807
4-benzhydryl-2-[[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 22674807) has the molecular formula C32H35F3N6O2 and a molecular weight of 592.67 g/mol. Its IUPAC name is 4-benzhydryl-2-[[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 4-benzhydryl-2-[[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 22674807 |
| Molecular Formula | C32H35F3N6O2 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.28 |
| IUPAC Name | 4-benzhydryl-2-[[2-(2-methoxyethoxy)-5-[5-(trifluoromethyl)tetrazol-1-yl]phenyl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COCCOc1ccc(-n2nnnc2C(F)(F)F)cc1CN1CC2CCCN2C(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C32H35F3N6O2/c1-42-17-18-43-29-15-14-26(41-31(32(33,34)35)36-37-38-41)19-25(29)20-39-21-27-13-8-16-40(27)28(22-39)30(23-9-4-2-5-10-23)24-11-6-3-7-12-24/h2-7,9-12,14-15,19,27-28,30H,8,13,16-18,20-22H2,1H3 |
| InChIKey | VENUEWCDNBJHCE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|