C33H35N3O — CID 70019386
(8aS)-4-benzhydryl-2-[(2-methoxy-5-pyridin-4-ylphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 70019386) has the molecular formula C33H35N3O and a molecular weight of 489.66 g/mol. Its IUPAC name is (8aS)-4-benzhydryl-2-[(2-methoxy-5-pyridin-4-ylphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-4-benzhydryl-2-[(2-methoxy-5-pyridin-4-ylphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 70019386 |
| Molecular Formula | C33H35N3O |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (8aS)-4-benzhydryl-2-[(2-methoxy-5-pyridin-4-ylphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1ccc(-c2ccncc2)cc1CN1CC(C(c2ccccc2)c2ccccc2)N2CCC[C@H]2C1 |
| InChI | InChI=1S/C33H35N3O/c1-37-32-15-14-28(25-16-18-34-19-17-25)21-29(32)22-35-23-30-13-8-20-36(30)31(24-35)33(26-9-4-2-5-10-26)27-11-6-3-7-12-27/h2-7,9-12,14-19,21,30-31,33H,8,13,20,22-24H2,1H3/t30-,31?/m0/s1 |
| InChIKey | VBWDLMHMHDNFJR-FSRLHOSWSA-N |
| XLogP | 6.24 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |