C29H36Cl2N2O2 — CID 70019734
(8aS)-4-benzhydryl-2-[(2,6-dimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride (PubChem CID 70019734) has the molecular formula C29H36Cl2N2O2 and a molecular weight of 515.53 g/mol. Its IUPAC name is (8aS)-4-benzhydryl-2-[(2,6-dimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride.
| Compound Name | (8aS)-4-benzhydryl-2-[(2,6-dimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
|---|---|
| PubChem CID | 70019734 |
| Molecular Formula | C29H36Cl2N2O2 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | (8aS)-4-benzhydryl-2-[(2,6-dimethoxyphenyl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;dihydrochloride |
| SMILES | COc1cccc(OC)c1CN1CC(C(c2ccccc2)c2ccccc2)N2CCC[C@H]2C1.Cl.Cl |
| InChI | InChI=1S/C29H34N2O2.2ClH/c1-32-27-16-9-17-28(33-2)25(27)20-30-19-24-15-10-18-31(24)26(21-30)29(22-11-5-3-6-12-22)23-13-7-4-8-14-23;;/h3-9,11-14,16-17,24,26,29H,10,15,18-21H2,1-2H3;2*1H/t24-,26?;;/m0../s1 |
| InChIKey | IXDGILSUZBASKY-QTTLMUINSA-N |
| XLogP | 6.03 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |