C28H34N2O3 — CID 22674612
2-benzhydryl-1-methyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 22674612) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is 2-benzhydryl-1-methyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 2-benzhydryl-1-methyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 22674612 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2-benzhydryl-1-methyl-4-[(2,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(OC)c(OC)cc1CN1CCN(C)C(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H34N2O3/c1-29-15-16-30(19-23-17-26(32-3)27(33-4)18-25(23)31-2)20-24(29)28(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,17-18,24,28H,15-16,19-20H2,1-4H3 |
| InChIKey | KRXVVXAWCFAWDR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |