C28H35N3O — CID 22674937
4-[(3-benzhydryl-4-methylpiperazin-1-yl)methyl]-3-methoxy-N,N-dimethylaniline (PubChem CID 22674937) has the molecular formula C28H35N3O and a molecular weight of 429.61 g/mol. Its IUPAC name is 4-[(3-benzhydryl-4-methylpiperazin-1-yl)methyl]-3-methoxy-N,N-dimethylaniline.
| Compound Name | 4-[(3-benzhydryl-4-methylpiperazin-1-yl)methyl]-3-methoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 22674937 |
| Molecular Formula | C28H35N3O |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.28 |
| IUPAC Name | 4-[(3-benzhydryl-4-methylpiperazin-1-yl)methyl]-3-methoxy-N,N-dimethylaniline |
| SMILES | COc1cc(N(C)C)ccc1CN1CCN(C)C(C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H35N3O/c1-29(2)25-16-15-24(27(19-25)32-4)20-31-18-17-30(3)26(21-31)28(22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-16,19,26,28H,17-18,20-21H2,1-4H3 |
| InChIKey | QSWVBBWIDQGRPS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|