C32H41Cl2N3O4 — CID 22674941
1-[4-benzhydryl-2-[(2,4,6-trimethoxyphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]ethanone;dihydrochloride (PubChem CID 22674941) has the molecular formula C32H41Cl2N3O4 and a molecular weight of 602.60 g/mol. Its IUPAC name is 1-[4-benzhydryl-2-[(2,4,6-trimethoxyphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]ethanone;dihydrochloride.
| Compound Name | 1-[4-benzhydryl-2-[(2,4,6-trimethoxyphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 22674941 |
| Molecular Formula | C32H41Cl2N3O4 |
| Molecular Weight | 602.60 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 1-[4-benzhydryl-2-[(2,4,6-trimethoxyphenyl)methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]ethanone;dihydrochloride |
| SMILES | COc1cc(OC)c(CN2CC3CN(C(C)=O)CCN3C(C(c3ccccc3)c3ccccc3)C2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C32H39N3O4.2ClH/c1-23(36)34-15-16-35-26(20-34)19-33(21-28-30(38-3)17-27(37-2)18-31(28)39-4)22-29(35)32(24-11-7-5-8-12-24)25-13-9-6-10-14-25;;/h5-14,17-18,26,29,32H,15-16,19-22H2,1-4H3;2*1H |
| InChIKey | VCGBFAMTCYUWAF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |