C35H39F2N7O4 — CID 87987807
[(9aR)-4-benzhydryl-2-[[4-(2,2-difluoroethoxy)-2-ethoxy-6-methoxypyrimidin-5-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-pyrazin-2-ylmethanone (PubChem CID 87987807) has the molecular formula C35H39F2N7O4 and a molecular weight of 659.74 g/mol. Its IUPAC name is [(9aR)-4-benzhydryl-2-[[4-(2,2-difluoroethoxy)-2-ethoxy-6-methoxypyrimidin-5-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(9aR)-4-benzhydryl-2-[[4-(2,2-difluoroethoxy)-2-ethoxy-6-methoxypyrimidin-5-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 87987807 |
| Molecular Formula | C35H39F2N7O4 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.30 |
| IUPAC Name | [(9aR)-4-benzhydryl-2-[[4-(2,2-difluoroethoxy)-2-ethoxy-6-methoxypyrimidin-5-yl]methyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-8-yl]-pyrazin-2-ylmethanone |
| SMILES | CCOc1nc(OC)c(CN2CC(C(c3ccccc3)c3ccccc3)N3CCN(C(=O)c4cnccn4)C[C@H]3C2)c(OCC(F)F)n1 |
| InChI | InChI=1S/C35H39F2N7O4/c1-3-47-35-40-32(46-2)27(33(41-35)48-23-30(36)37)21-42-19-26-20-43(34(45)28-18-38-14-15-39-28)16-17-44(26)29(22-42)31(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-15,18,26,29-31H,3,16-17,19-23H2,1-2H3/t26-,29?/m1/s1 |
| InChIKey | FLGVXSMOJDILBM-QZWVJJBASA-N |
| XLogP | 4.16 |
| TPSA | 106.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |