C35H62N2O2 — CID 70021090
[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[4-(ethylamino)butylamino]acetate (PubChem CID 70021090) has the molecular formula C35H62N2O2 and a molecular weight of 542.89 g/mol. Its IUPAC name is [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[4-(ethylamino)butylamino]acetate.
| Compound Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[4-(ethylamino)butylamino]acetate |
|---|---|
| PubChem CID | 70021090 |
| Molecular Formula | C35H62N2O2 |
| Molecular Weight | 542.89 g/mol |
| Exact Mass | 542.48 |
| IUPAC Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[4-(ethylamino)butylamino]acetate |
| SMILES | CCNCCCCNCC(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C35H62N2O2/c1-7-36-21-8-9-22-37-24-33(38)39-28-17-19-34(5)27(23-28)13-14-29-31-16-15-30(26(4)12-10-11-25(2)3)35(31,6)20-18-32(29)34/h13,25-26,28-32,36-37H,7-12,14-24H2,1-6H3/t26-,28?,29?,30-,31?,32?,34+,35-/m1/s1 |
| InChIKey | LXEPPHIYBQYLIL-GRHZLFEWSA-N |
| XLogP | 7.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.89 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|