C36H64N2O2 — CID 70021362
[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[5-(ethylamino)pentylamino]acetate (PubChem CID 70021362) has the molecular formula C36H64N2O2 and a molecular weight of 556.92 g/mol. Its IUPAC name is [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[5-(ethylamino)pentylamino]acetate.
| Compound Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[5-(ethylamino)pentylamino]acetate |
|---|---|
| PubChem CID | 70021362 |
| Molecular Formula | C36H64N2O2 |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.50 |
| IUPAC Name | [(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 2-[5-(ethylamino)pentylamino]acetate |
| SMILES | CCNCCCCCNCC(=O)OC1CC[C@@]2(C)C(=CCC3C2CC[C@@]2(C)C3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| InChI | InChI=1S/C36H64N2O2/c1-7-37-22-9-8-10-23-38-25-34(39)40-29-18-20-35(5)28(24-29)14-15-30-32-17-16-31(27(4)13-11-12-26(2)3)36(32,6)21-19-33(30)35/h14,26-27,29-33,37-38H,7-13,15-25H2,1-6H3/t27-,29?,30?,31-,32?,33?,35+,36-/m1/s1 |
| InChIKey | BUBMJGIEHCYNKJ-WYKOVRGBSA-N |
| XLogP | 8.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|