C18H35N3O2 — CID 70023388
1-(2-cyclohexylethyl)-1-(2-hydroxyethyl)-3-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]urea (PubChem CID 70023388) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-1-(2-hydroxyethyl)-3-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]urea.
| Compound Name | 1-(2-cyclohexylethyl)-1-(2-hydroxyethyl)-3-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]urea |
|---|---|
| PubChem CID | 70023388 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | 1-(2-cyclohexylethyl)-1-(2-hydroxyethyl)-3-[2-[(2S)-1-methylpyrrolidin-2-yl]ethyl]urea |
| SMILES | CN1CCC[C@H]1CCNC(=O)N(CCO)CCC1CCCCC1 |
| InChI | InChI=1S/C18H35N3O2/c1-20-12-5-8-17(20)9-11-19-18(23)21(14-15-22)13-10-16-6-3-2-4-7-16/h16-17,22H,2-15H2,1H3,(H,19,23)/t17-/m0/s1 |
| InChIKey | GTKAGKYRUPYPLR-KRWDZBQOSA-N |
| XLogP | 2.44 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |