C16H26N4O — CID 119059632
1-ethyl-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-1-(pyridin-4-ylmethyl)urea (PubChem CID 119059632) has the molecular formula C16H26N4O and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-1-(pyridin-4-ylmethyl)urea.
| Compound Name | 1-ethyl-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-1-(pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 119059632 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1-ethyl-3-[2-(1-methylpyrrolidin-2-yl)ethyl]-1-(pyridin-4-ylmethyl)urea |
| SMILES | CCN(Cc1ccncc1)C(=O)NCCC1CCCN1C |
| InChI | InChI=1S/C16H26N4O/c1-3-20(13-14-6-9-17-10-7-14)16(21)18-11-8-15-5-4-12-19(15)2/h6-7,9-10,15H,3-5,8,11-13H2,1-2H3,(H,18,21) |
| InChIKey | YUNPPFJPSNXQDY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |