C15H19N2O2+ — CID 7002417
(1R,9S)-11-(4-hydroxybut-2-ynyl)-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 7002417) has the molecular formula C15H19N2O2+ and a molecular weight of 259.33 g/mol. Its IUPAC name is (1R,9S)-11-(4-hydroxybut-2-ynyl)-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1R,9S)-11-(4-hydroxybut-2-ynyl)-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 7002417 |
| Molecular Formula | C15H19N2O2+ |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (1R,9S)-11-(4-hydroxybut-2-ynyl)-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1C[C@@H]1C[C@@H]2C[NH+](CC#CCO)C1 |
| InChI | InChI=1S/C15H18N2O2/c18-7-2-1-6-16-9-12-8-13(11-16)14-4-3-5-15(19)17(14)10-12/h3-5,12-13,18H,6-11H2/p+1/t12-,13-/m1/s1 |
| InChIKey | YMPARQHFOKPMLE-CHWSQXEVSA-O |
| XLogP | -1.15 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|