C18H21N2O2+ — CID 7429529
(1S,9S)-11-[(2-hydroxyphenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 7429529) has the molecular formula C18H21N2O2+ and a molecular weight of 297.38 g/mol. Its IUPAC name is (1S,9S)-11-[(2-hydroxyphenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[(2-hydroxyphenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 7429529 |
| Molecular Formula | C18H21N2O2+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (1S,9S)-11-[(2-hydroxyphenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1C[C@@H]1C[C@H]2C[NH+](Cc2ccccc2O)C1 |
| InChI | InChI=1S/C18H20N2O2/c21-17-6-2-1-4-14(17)11-19-9-13-8-15(12-19)16-5-3-7-18(22)20(16)10-13/h1-7,13,15,21H,8-12H2/p+1/t13-,15+/m1/s1 |
| InChIKey | BGTJGEQBHLWNGX-HIFRSBDPSA-O |
| XLogP | 0.76 |
| TPSA | 46.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|