C20H24N3O5+ — CID 7454074
(1S,9S)-11-[(4,5-dimethoxy-2-nitrophenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 7454074) has the molecular formula C20H24N3O5+ and a molecular weight of 386.43 g/mol. Its IUPAC name is (1S,9S)-11-[(4,5-dimethoxy-2-nitrophenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[(4,5-dimethoxy-2-nitrophenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 7454074 |
| Molecular Formula | C20H24N3O5+ |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (1S,9S)-11-[(4,5-dimethoxy-2-nitrophenyl)methyl]-7-aza-11-azoniatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | COc1cc(C[NH+]2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H23N3O5/c1-27-18-7-15(17(23(25)26)8-19(18)28-2)12-21-9-13-6-14(11-21)16-4-3-5-20(24)22(16)10-13/h3-5,7-8,13-14H,6,9-12H2,1-2H3/p+1/t13-,14+/m1/s1 |
| InChIKey | GHJBVRNDGRVKAT-KGLIPLIRSA-O |
| XLogP | 0.98 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|