C27H28N4O7 — CID 92694977
3-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 92694977) has the molecular formula C27H28N4O7 and a molecular weight of 520.54 g/mol. Its IUPAC name is 3-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 3-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 92694977 |
| Molecular Formula | C27H28N4O7 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | 3-nitro-4-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccc(N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H28N4O7/c1-36-23-11-19(12-24(37-2)26(23)38-3)28-27(33)17-7-8-21(22(10-17)31(34)35)29-13-16-9-18(15-29)20-5-4-6-25(32)30(20)14-16/h4-8,10-12,16,18H,9,13-15H2,1-3H3,(H,28,33)/t16-,18+/m1/s1 |
| InChIKey | VEUVHJBSMQRDHN-AEFFLSMTSA-N |
| XLogP | 3.66 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|