C25H24N4O5 — CID 15993053
N-(2-methoxyphenyl)-3-nitro-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide (PubChem CID 15993053) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-nitro-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide.
| Compound Name | N-(2-methoxyphenyl)-3-nitro-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
|---|---|
| PubChem CID | 15993053 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-(2-methoxyphenyl)-3-nitro-4-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)benzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(N2CC3CC(C2)c2cccc(=O)n2C3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H24N4O5/c1-34-23-7-3-2-5-19(23)26-25(31)17-9-10-21(22(12-17)29(32)33)27-13-16-11-18(15-27)20-6-4-8-24(30)28(20)14-16/h2-10,12,16,18H,11,13-15H2,1H3,(H,26,31) |
| InChIKey | AOZOLYMGWPLLFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|