C31H29ClN4O5S — CID 98350944
N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]thiophene-2-carboxamide (PubChem CID 98350944) has the molecular formula C31H29ClN4O5S and a molecular weight of 605.12 g/mol. Its IUPAC name is N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 98350944 |
| Molecular Formula | C31H29ClN4O5S |
| Molecular Weight | 605.12 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | N-[5-[(5-chloro-2,4-dimethoxyphenyl)carbamoyl]-2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1cc(OC)c(NC(=O)c2ccc(N3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)c(NC(=O)c3cccs3)c2)cc1Cl |
| InChI | InChI=1S/C31H29ClN4O5S/c1-40-26-14-27(41-2)23(13-21(26)32)34-30(38)19-8-9-25(22(12-19)33-31(39)28-6-4-10-42-28)35-15-18-11-20(17-35)24-5-3-7-29(37)36(24)16-18/h3-10,12-14,18,20H,11,15-17H2,1-2H3,(H,33,39)(H,34,38)/t18-,20+/m1/s1 |
| InChIKey | ZYKOBRBKPPOQEB-QUCCMNQESA-N |
| XLogP | 5.71 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.12 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |