C25H22F2N4O3 — CID 70024821
4-ethyl-8-fluoro-9-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxobenzo[f][1,7]naphthyridine-3-carboxylic acid (PubChem CID 70024821) has the molecular formula C25H22F2N4O3 and a molecular weight of 464.47 g/mol. Its IUPAC name is 4-ethyl-8-fluoro-9-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxobenzo[f][1,7]naphthyridine-3-carboxylic acid.
| Compound Name | 4-ethyl-8-fluoro-9-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxobenzo[f][1,7]naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 70024821 |
| Molecular Formula | C25H22F2N4O3 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 4-ethyl-8-fluoro-9-[4-(4-fluorophenyl)piperazin-1-yl]-1-oxobenzo[f][1,7]naphthyridine-3-carboxylic acid |
| SMILES | CCn1c(C(=O)O)cc(=O)c2c3cc(N4CCN(c5ccc(F)cc5)CC4)c(F)cc3ncc21 |
| InChI | InChI=1S/C25H22F2N4O3/c1-2-31-21(25(33)34)13-23(32)24-17-11-20(18(27)12-19(17)28-14-22(24)31)30-9-7-29(8-10-30)16-5-3-15(26)4-6-16/h3-6,11-14H,2,7-10H2,1H3,(H,33,34) |
| InChIKey | AUASSGXXVSPDRH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|