C20H19F2N3O — CID 141216800
6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one (PubChem CID 141216800) has the molecular formula C20H19F2N3O and a molecular weight of 355.39 g/mol. Its IUPAC name is 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one.
| Compound Name | 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one |
|---|---|
| PubChem CID | 141216800 |
| Molecular Formula | C20H19F2N3O |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)quinolin-4-one |
| SMILES | CN1CCN(c2cc3c(cc2F)c(=O)ccn3-c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H19F2N3O/c1-23-8-10-24(11-9-23)19-13-18-16(12-17(19)22)20(26)6-7-25(18)15-4-2-14(21)3-5-15/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | ZNZMIGCDUXJWQF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |