C24H27F2N3O — CID 56956863
2,7-difluoro-10-methyl-3,6-di(piperidin-1-yl)acridin-9-one (PubChem CID 56956863) has the molecular formula C24H27F2N3O and a molecular weight of 411.50 g/mol. Its IUPAC name is 2,7-difluoro-10-methyl-3,6-di(piperidin-1-yl)acridin-9-one.
| Compound Name | 2,7-difluoro-10-methyl-3,6-di(piperidin-1-yl)acridin-9-one |
|---|---|
| PubChem CID | 56956863 |
| Molecular Formula | C24H27F2N3O |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2,7-difluoro-10-methyl-3,6-di(piperidin-1-yl)acridin-9-one |
| SMILES | Cn1c2cc(N3CCCCC3)c(F)cc2c(=O)c2cc(F)c(N3CCCCC3)cc21 |
| InChI | InChI=1S/C24H27F2N3O/c1-27-20-14-22(28-8-4-2-5-9-28)18(25)12-16(20)24(30)17-13-19(26)23(15-21(17)27)29-10-6-3-7-11-29/h12-15H,2-11H2,1H3 |
| InChIKey | YTHGQKBLTWDZOW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|