C23H24F2N2O2 — CID 56956701
2,7-difluoro-3,6-di(piperidin-1-yl)xanthen-9-one (PubChem CID 56956701) has the molecular formula C23H24F2N2O2 and a molecular weight of 398.45 g/mol. Its IUPAC name is 2,7-difluoro-3,6-di(piperidin-1-yl)xanthen-9-one.
| Compound Name | 2,7-difluoro-3,6-di(piperidin-1-yl)xanthen-9-one |
|---|---|
| PubChem CID | 56956701 |
| Molecular Formula | C23H24F2N2O2 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 2,7-difluoro-3,6-di(piperidin-1-yl)xanthen-9-one |
| SMILES | O=c1c2cc(F)c(N3CCCCC3)cc2oc2cc(N3CCCCC3)c(F)cc12 |
| InChI | InChI=1S/C23H24F2N2O2/c24-17-11-15-21(13-19(17)26-7-3-1-4-8-26)29-22-14-20(27-9-5-2-6-10-27)18(25)12-16(22)23(15)28/h11-14H,1-10H2 |
| InChIKey | JSNNUSCGPSMEPK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|