C12H17NO2 — CID 121011091
5,6-dimethyl-4-piperidin-1-ylpyran-2-one (PubChem CID 121011091) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 5,6-dimethyl-4-piperidin-1-ylpyran-2-one.
| Compound Name | 5,6-dimethyl-4-piperidin-1-ylpyran-2-one |
|---|---|
| PubChem CID | 121011091 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 5,6-dimethyl-4-piperidin-1-ylpyran-2-one |
| SMILES | Cc1oc(=O)cc(N2CCCCC2)c1C |
| InChI | InChI=1S/C12H17NO2/c1-9-10(2)15-12(14)8-11(9)13-6-4-3-5-7-13/h8H,3-7H2,1-2H3 |
| InChIKey | XZMBIZBKJVPXCO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |