C27H30FN3O — CID 71157953
7-(azepan-1-yl)-1-[(4-tert-butylphenyl)methyl]-6-fluoro-4-oxoquinoline-3-carbonitrile (PubChem CID 71157953) has the molecular formula C27H30FN3O and a molecular weight of 431.56 g/mol. Its IUPAC name is 7-(azepan-1-yl)-1-[(4-tert-butylphenyl)methyl]-6-fluoro-4-oxoquinoline-3-carbonitrile.
| Compound Name | 7-(azepan-1-yl)-1-[(4-tert-butylphenyl)methyl]-6-fluoro-4-oxoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 71157953 |
| Molecular Formula | C27H30FN3O |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 7-(azepan-1-yl)-1-[(4-tert-butylphenyl)methyl]-6-fluoro-4-oxoquinoline-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc(Cn2cc(C#N)c(=O)c3cc(F)c(N4CCCCCC4)cc32)cc1 |
| InChI | InChI=1S/C27H30FN3O/c1-27(2,3)21-10-8-19(9-11-21)17-31-18-20(16-29)26(32)22-14-23(28)25(15-24(22)31)30-12-6-4-5-7-13-30/h8-11,14-15,18H,4-7,12-13,17H2,1-3H3 |
| InChIKey | ZZEPBGWABGOYDN-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |