C17H20FN3O2 — CID 164579236
1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-3-hydroxy-2-methylpyridin-4-one (PubChem CID 164579236) has the molecular formula C17H20FN3O2 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-3-hydroxy-2-methylpyridin-4-one.
| Compound Name | 1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-3-hydroxy-2-methylpyridin-4-one |
|---|---|
| PubChem CID | 164579236 |
| Molecular Formula | C17H20FN3O2 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 1-[3-fluoro-4-(4-methylpiperazin-1-yl)phenyl]-3-hydroxy-2-methylpyridin-4-one |
| SMILES | Cc1c(O)c(=O)ccn1-c1ccc(N2CCN(C)CC2)c(F)c1 |
| InChI | InChI=1S/C17H20FN3O2/c1-12-17(23)16(22)5-6-21(12)13-3-4-15(14(18)11-13)20-9-7-19(2)8-10-20/h3-6,11,23H,7-10H2,1-2H3 |
| InChIKey | IMYCJZPVTPKJEA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|