C18H36N4 — CID 70026020
1-[3-(2-imidazolidin-1-ylpropan-2-yl)-2,4-dimethylhex-3-en-2-yl]piperazine (PubChem CID 70026020) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[3-(2-imidazolidin-1-ylpropan-2-yl)-2,4-dimethylhex-3-en-2-yl]piperazine.
| Compound Name | 1-[3-(2-imidazolidin-1-ylpropan-2-yl)-2,4-dimethylhex-3-en-2-yl]piperazine |
|---|---|
| PubChem CID | 70026020 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 1-[3-(2-imidazolidin-1-ylpropan-2-yl)-2,4-dimethylhex-3-en-2-yl]piperazine |
| SMILES | CCC(C)=C(C(C)(C)N1CCNCC1)C(C)(C)N1CCNC1 |
| InChI | InChI=1S/C18H36N4/c1-7-15(2)16(18(5,6)22-13-10-20-14-22)17(3,4)21-11-8-19-9-12-21/h19-20H,7-14H2,1-6H3 |
| InChIKey | TXJZHKDIMMGYJM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|