C31H40N2O4 — CID 70026990
(2S,3R,6S)-2,6-dibenzyl-3-methyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione (PubChem CID 70026990) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is (2S,3R,6S)-2,6-dibenzyl-3-methyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione.
| Compound Name | (2S,3R,6S)-2,6-dibenzyl-3-methyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione |
|---|---|
| PubChem CID | 70026990 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | (2S,3R,6S)-2,6-dibenzyl-3-methyl-4-methylidene-1,7-dimorpholin-4-ylheptane-1,7-dione |
| SMILES | C=C(C[C@@H](Cc1ccccc1)C(=O)N1CCOCC1)[C@H](C)[C@H](Cc1ccccc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C31H40N2O4/c1-24(21-28(22-26-9-5-3-6-10-26)30(34)32-13-17-36-18-14-32)25(2)29(23-27-11-7-4-8-12-27)31(35)33-15-19-37-20-16-33/h3-12,25,28-29H,1,13-23H2,2H3/t25-,28-,29-/m0/s1 |
| InChIKey | FVUCFWNFQMXDRC-FMYROPPKSA-N |
| XLogP | 4.00 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|